C11H17Cl2NO — CID 93233548
(1R)-2,2-dichloro-N-(cyclopentylmethyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 93233548) has the molecular formula C11H17Cl2NO and a molecular weight of 250.17 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-(cyclopentylmethyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-(cyclopentylmethyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 93233548 |
| Molecular Formula | C11H17Cl2NO |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | (1R)-2,2-dichloro-N-(cyclopentylmethyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)NCC2CCCC2)CC1(Cl)Cl |
| InChI | InChI=1S/C11H17Cl2NO/c1-10(7-11(10,12)13)9(15)14-6-8-4-2-3-5-8/h8H,2-7H2,1H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | MXMNTVWKFASJCS-SNVBAGLBSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|