C10H10ClN3O2 — CID 115924726
3-chloro-2-[[(5-methyl-1,3,4-oxadiazol-2-yl)amino]methyl]phenol (PubChem CID 115924726) has the molecular formula C10H10ClN3O2 and a molecular weight of 239.66 g/mol. Its IUPAC name is 3-chloro-2-[[(5-methyl-1,3,4-oxadiazol-2-yl)amino]methyl]phenol.
| Compound Name | 3-chloro-2-[[(5-methyl-1,3,4-oxadiazol-2-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 115924726 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 3-chloro-2-[[(5-methyl-1,3,4-oxadiazol-2-yl)amino]methyl]phenol |
| SMILES | Cc1nnc(NCc2c(O)cccc2Cl)o1 |
| InChI | InChI=1S/C10H10ClN3O2/c1-6-13-14-10(16-6)12-5-7-8(11)3-2-4-9(7)15/h2-4,15H,5H2,1H3,(H,12,14) |
| InChIKey | CQZLKMIYLMDXMY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|