C13H17N3O2 — CID 115928972
N-(3-methoxybutan-2-yl)-4-(1,3,4-oxadiazol-2-yl)aniline (PubChem CID 115928972) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is N-(3-methoxybutan-2-yl)-4-(1,3,4-oxadiazol-2-yl)aniline.
| Compound Name | N-(3-methoxybutan-2-yl)-4-(1,3,4-oxadiazol-2-yl)aniline |
|---|---|
| PubChem CID | 115928972 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N-(3-methoxybutan-2-yl)-4-(1,3,4-oxadiazol-2-yl)aniline |
| SMILES | COC(C)C(C)Nc1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C13H17N3O2/c1-9(10(2)17-3)15-12-6-4-11(5-7-12)13-16-14-8-18-13/h4-10,15H,1-3H3 |
| InChIKey | AJKBZXFPSAZUOI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |