4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid

C15H21N3O3 — CID 115937445

IUPAC4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid
SMILESCCCCCCOc1c(C(=O)O)cnc2c1c(C)nn2C
InChIInChI=1S/C15H21N3O3/c1-4-5-6-7-8-21-13-11(15(19)20)9-16-14-12(13)10(2)17-18(14)3/h9H,4-8H2,1-3H3,(H,19,20)
InChIKeyHQVCWNNWODTRKC-UHFFFAOYSA-N
MW291.35 g/mol
LogP2.93
Rot. Bonds7

About 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid

4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid (PubChem CID 115937445) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid.

Molecular Properties

Compound Name4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid
PubChem CID115937445
Molecular FormulaC15H21N3O3
Molecular Weight291.35 g/mol
Exact Mass291.16
IUPAC Name4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid
SMILESCCCCCCOc1c(C(=O)O)cnc2c1c(C)nn2C
InChIInChI=1S/C15H21N3O3/c1-4-5-6-7-8-21-13-11(15(19)20)9-16-14-12(13)10(2)17-18(14)3/h9H,4-8H2,1-3H3,(H,19,20)
InChIKeyHQVCWNNWODTRKC-UHFFFAOYSA-N
XLogP2.93
TPSA77.24 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.35
LogP ≤ 52.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid?
The IUPAC name of 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid (CID 115937445) is 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid.
What is the SMILES notation for 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid?
The canonical SMILES for 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid is CCCCCCOc1c(C(=O)O)cnc2c1c(C)nn2C.
What is the InChIKey of 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid?
The InChIKey is HQVCWNNWODTRKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O3/c1-4-5-6-7-8-21-13-11(15(19)20)9-16-14-12(13)10(2)17-18(14)3/h9H,4-8H2,1-3H3,(H,19,20).
What are the key properties of 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid?
4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid has a molecular weight of 291.35 g/mol, XLogP of 2.93, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexoxy-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid is sourced from PubChem (CID 115937445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).