C16H32N2O2 — CID 115944261
5-(aminomethyl)-3-dodecyl-1,3-oxazolidin-2-one (PubChem CID 115944261) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 5-(aminomethyl)-3-dodecyl-1,3-oxazolidin-2-one.
| Compound Name | 5-(aminomethyl)-3-dodecyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115944261 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 5-(aminomethyl)-3-dodecyl-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCCCCCN1CC(CN)OC1=O |
| InChI | InChI=1S/C16H32N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-18-14-15(13-17)20-16(18)19/h15H,2-14,17H2,1H3 |
| InChIKey | NVRQFFOTKWSAOH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|