C10H20N2O2 — CID 117010734
6-(aminomethyl)-3-pentyl-1,3-oxazinan-2-one (PubChem CID 117010734) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 6-(aminomethyl)-3-pentyl-1,3-oxazinan-2-one.
| Compound Name | 6-(aminomethyl)-3-pentyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 117010734 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 6-(aminomethyl)-3-pentyl-1,3-oxazinan-2-one |
| SMILES | CCCCCN1CCC(CN)OC1=O |
| InChI | InChI=1S/C10H20N2O2/c1-2-3-4-6-12-7-5-9(8-11)14-10(12)13/h9H,2-8,11H2,1H3 |
| InChIKey | YDQYWSMRKPPTDF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|