About 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one
5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one (PubChem CID 159459303) has the molecular formula C32H61ClN2O3
and a molecular weight of 557.30 g/mol. Its IUPAC name is 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one |
| PubChem CID | 159459303 |
| Molecular Formula | C32H61ClN2O3 |
| Molecular Weight | 557.30 g/mol |
| Exact Mass | 556.44 |
| IUPAC Name | 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one |
| SMILES | CCCCCCCCCCCCN1CC(CCl)OC1=O.CCCCCCCCCCCCN1CCCC1=O |
| InChI | InChI=1S/C16H30ClNO2.C16H31NO/c1-2-3-4-5-6-7-8-9-10-11-12-18-14-15(13-17)20-16(18)19;1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16(17)18/h15H,2-14H2,1H3;2-15H2,1H3 |
| InChIKey | LUJOWZIZMGJGKL-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 557.30 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one?
The IUPAC name of 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one (CID 159459303) is 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one.
What is the SMILES notation for 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one?
The canonical SMILES for 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one is CCCCCCCCCCCCN1CC(CCl)OC1=O.CCCCCCCCCCCCN1CCCC1=O.
What is the InChIKey of 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one?
The InChIKey is LUJOWZIZMGJGKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30ClNO2.C16H31NO/c1-2-3-4-5-6-7-8-9-10-11-12-18-14-15(13-17)20-16(18)19;1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16(17)18/h15H,2-14H2,1H3;2-15H2,1H3.
What are the key properties of 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one?
5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one has a molecular weight of 557.30 g/mol, XLogP of 9.50, 23 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-3-dodecyl-1,3-oxazolidin-2-one;1-dodecylpyrrolidin-2-one is sourced from PubChem (CID 159459303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).