C13H19N3O4 — CID 115947688
7-(1-morpholin-4-ylpropan-2-yl)-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 115947688) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is 7-(1-morpholin-4-ylpropan-2-yl)-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-(1-morpholin-4-ylpropan-2-yl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 115947688 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 7-(1-morpholin-4-ylpropan-2-yl)-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | CC(CN1CCOCC1)N1C(=O)NC(=O)C2(CC2)C1=O |
| InChI | InChI=1S/C13H19N3O4/c1-9(8-15-4-6-20-7-5-15)16-11(18)13(2-3-13)10(17)14-12(16)19/h9H,2-8H2,1H3,(H,14,17,19) |
| InChIKey | CMDPODYJLYFWPZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|