C13H20N2O3 — CID 112598786
4-propan-2-yl-2,4-diazaspiro[5.6]dodecane-1,3,5-trione (PubChem CID 112598786) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 4-propan-2-yl-2,4-diazaspiro[5.6]dodecane-1,3,5-trione.
| Compound Name | 4-propan-2-yl-2,4-diazaspiro[5.6]dodecane-1,3,5-trione |
|---|---|
| PubChem CID | 112598786 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 4-propan-2-yl-2,4-diazaspiro[5.6]dodecane-1,3,5-trione |
| SMILES | CC(C)N1C(=O)NC(=O)C2(CCCCCC2)C1=O |
| InChI | InChI=1S/C13H20N2O3/c1-9(2)15-11(17)13(10(16)14-12(15)18)7-5-3-4-6-8-13/h9H,3-8H2,1-2H3,(H,14,16,18) |
| InChIKey | VNILOWNGDYQBRW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|