C12H17N3O4 — CID 112599394
2-(1,3,5-trioxo-2,4-diazaspiro[5.5]undecan-4-yl)propanamide (PubChem CID 112599394) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(1,3,5-trioxo-2,4-diazaspiro[5.5]undecan-4-yl)propanamide.
| Compound Name | 2-(1,3,5-trioxo-2,4-diazaspiro[5.5]undecan-4-yl)propanamide |
|---|---|
| PubChem CID | 112599394 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-(1,3,5-trioxo-2,4-diazaspiro[5.5]undecan-4-yl)propanamide |
| SMILES | CC(C(N)=O)N1C(=O)NC(=O)C2(CCCCC2)C1=O |
| InChI | InChI=1S/C12H17N3O4/c1-7(8(13)16)15-10(18)12(5-3-2-4-6-12)9(17)14-11(15)19/h7H,2-6H2,1H3,(H2,13,16)(H,14,17,19) |
| InChIKey | YXOKUKRHXAEDEL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|