C10H10N2O3 — CID 114421008
7-but-3-yn-2-yl-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 114421008) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is 7-but-3-yn-2-yl-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-but-3-yn-2-yl-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 114421008 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | 7-but-3-yn-2-yl-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | C#CC(C)N1C(=O)NC(=O)C2(CC2)C1=O |
| InChI | InChI=1S/C10H10N2O3/c1-3-6(2)12-8(14)10(4-5-10)7(13)11-9(12)15/h1,6H,4-5H2,2H3,(H,11,13,15) |
| InChIKey | NPNSHXGFFBSZBU-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|