C14H22N2O3 — CID 112599241
9-(4-methylpentan-2-yl)-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 112599241) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 9-(4-methylpentan-2-yl)-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 9-(4-methylpentan-2-yl)-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 112599241 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 9-(4-methylpentan-2-yl)-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | CC(C)CC(C)N1C(=O)NC(=O)C2(CCCC2)C1=O |
| InChI | InChI=1S/C14H22N2O3/c1-9(2)8-10(3)16-12(18)14(6-4-5-7-14)11(17)15-13(16)19/h9-10H,4-8H2,1-3H3,(H,15,17,19) |
| InChIKey | DNTPQNQPLVGENS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|