C15H18N2O4 — CID 115947250
9-[1-(5-methylfuran-2-yl)ethyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 115947250) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 9-[1-(5-methylfuran-2-yl)ethyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 9-[1-(5-methylfuran-2-yl)ethyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 115947250 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 9-[1-(5-methylfuran-2-yl)ethyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | Cc1ccc(C(C)N2C(=O)NC(=O)C3(CCCC3)C2=O)o1 |
| InChI | InChI=1S/C15H18N2O4/c1-9-5-6-11(21-9)10(2)17-13(19)15(7-3-4-8-15)12(18)16-14(17)20/h5-6,10H,3-4,7-8H2,1-2H3,(H,16,18,20) |
| InChIKey | KOLGFAXLMWALTG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|