C13H14N2O4 — CID 112600468
8-[(5-methylfuran-2-yl)methyl]-6,8-diazaspiro[3.5]nonane-5,7,9-trione (PubChem CID 112600468) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is 8-[(5-methylfuran-2-yl)methyl]-6,8-diazaspiro[3.5]nonane-5,7,9-trione.
| Compound Name | 8-[(5-methylfuran-2-yl)methyl]-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
|---|---|
| PubChem CID | 112600468 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 8-[(5-methylfuran-2-yl)methyl]-6,8-diazaspiro[3.5]nonane-5,7,9-trione |
| SMILES | Cc1ccc(CN2C(=O)NC(=O)C3(CCC3)C2=O)o1 |
| InChI | InChI=1S/C13H14N2O4/c1-8-3-4-9(19-8)7-15-11(17)13(5-2-6-13)10(16)14-12(15)18/h3-4H,2,5-7H2,1H3,(H,14,16,18) |
| InChIKey | MTBRXFBAQCXBIR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|