C13H15N3O4 — CID 106377426
9-[(5-methyl-1,3-oxazol-2-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione (PubChem CID 106377426) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 9-[(5-methyl-1,3-oxazol-2-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione.
| Compound Name | 9-[(5-methyl-1,3-oxazol-2-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
|---|---|
| PubChem CID | 106377426 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 9-[(5-methyl-1,3-oxazol-2-yl)methyl]-7,9-diazaspiro[4.5]decane-6,8,10-trione |
| SMILES | Cc1cnc(CN2C(=O)NC(=O)C3(CCCC3)C2=O)o1 |
| InChI | InChI=1S/C13H15N3O4/c1-8-6-14-9(20-8)7-16-11(18)13(4-2-3-5-13)10(17)15-12(16)19/h6H,2-5,7H2,1H3,(H,15,17,19) |
| InChIKey | JBAPPKRGQNCPJS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|