C12H14N4O3 — CID 106040440
7-[(1,5-dimethylpyrazol-4-yl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 106040440) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 7-[(1,5-dimethylpyrazol-4-yl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-[(1,5-dimethylpyrazol-4-yl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 106040440 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 7-[(1,5-dimethylpyrazol-4-yl)methyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | Cc1c(CN2C(=O)NC(=O)C3(CC3)C2=O)cnn1C |
| InChI | InChI=1S/C12H14N4O3/c1-7-8(5-13-15(7)2)6-16-10(18)12(3-4-12)9(17)14-11(16)19/h5H,3-4,6H2,1-2H3,(H,14,17,19) |
| InChIKey | LVJOOLJQTJHDIP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|