C14H17N3O4 — CID 106377422
4-[(5-methyl-1,3-oxazol-2-yl)methyl]-2,4-diazaspiro[5.5]undecane-1,3,5-trione (PubChem CID 106377422) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 4-[(5-methyl-1,3-oxazol-2-yl)methyl]-2,4-diazaspiro[5.5]undecane-1,3,5-trione.
| Compound Name | 4-[(5-methyl-1,3-oxazol-2-yl)methyl]-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| PubChem CID | 106377422 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 4-[(5-methyl-1,3-oxazol-2-yl)methyl]-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
| SMILES | Cc1cnc(CN2C(=O)NC(=O)C3(CCCCC3)C2=O)o1 |
| InChI | InChI=1S/C14H17N3O4/c1-9-7-15-10(21-9)8-17-12(19)14(5-3-2-4-6-14)11(18)16-13(17)20/h7H,2-6,8H2,1H3,(H,16,18,20) |
| InChIKey | MDFHDWPBCYVVGF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|