C13H16N4O4 — CID 106410048
4-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2,4-diazaspiro[5.5]undecane-1,3,5-trione (PubChem CID 106410048) has the molecular formula C13H16N4O4 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2,4-diazaspiro[5.5]undecane-1,3,5-trione.
| Compound Name | 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
|---|---|
| PubChem CID | 106410048 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-2,4-diazaspiro[5.5]undecane-1,3,5-trione |
| SMILES | Cc1nc(CN2C(=O)NC(=O)C3(CCCCC3)C2=O)no1 |
| InChI | InChI=1S/C13H16N4O4/c1-8-14-9(16-21-8)7-17-11(19)13(5-3-2-4-6-13)10(18)15-12(17)20/h2-7H2,1H3,(H,15,18,20) |
| InChIKey | CNVWJMJYSKIBNV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|