C10H12N2O3 — CID 79776757
1-[1-(5-methylfuran-2-yl)ethyl]imidazolidine-2,4-dione (PubChem CID 79776757) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 1-[1-(5-methylfuran-2-yl)ethyl]imidazolidine-2,4-dione.
| Compound Name | 1-[1-(5-methylfuran-2-yl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 79776757 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 1-[1-(5-methylfuran-2-yl)ethyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C(C)N2CC(=O)NC2=O)o1 |
| InChI | InChI=1S/C10H12N2O3/c1-6-3-4-8(15-6)7(2)12-5-9(13)11-10(12)14/h3-4,7H,5H2,1-2H3,(H,11,13,14) |
| InChIKey | FCWATMHLTJWKOU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|