C16H21NO4 — CID 115957315
(E)-3-[2-[2-(diethylamino)-2-oxoethoxy]-3-methylphenyl]prop-2-enoic acid (PubChem CID 115957315) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is (E)-3-[2-[2-(diethylamino)-2-oxoethoxy]-3-methylphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[2-(diethylamino)-2-oxoethoxy]-3-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115957315 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | (E)-3-[2-[2-(diethylamino)-2-oxoethoxy]-3-methylphenyl]prop-2-enoic acid |
| SMILES | CCN(CC)C(=O)COc1c(C)cccc1/C=C/C(=O)O |
| InChI | InChI=1S/C16H21NO4/c1-4-17(5-2)14(18)11-21-16-12(3)7-6-8-13(16)9-10-15(19)20/h6-10H,4-5,11H2,1-3H3,(H,19,20)/b10-9+ |
| InChIKey | IPBRZKQQDIZXDZ-MDZDMXLPSA-N |
| XLogP | 2.34 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|