C24H21NO3 — CID 11595859
3-[3-[(5E)-5-benzylidene-1-hydroxy-4-oxocyclopent-2-en-1-yl]prop-1-ynyl]-N,N-dimethylbenzamide (PubChem CID 11595859) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-[3-[(5E)-5-benzylidene-1-hydroxy-4-oxocyclopent-2-en-1-yl]prop-1-ynyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[3-[(5E)-5-benzylidene-1-hydroxy-4-oxocyclopent-2-en-1-yl]prop-1-ynyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 11595859 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 3-[3-[(5E)-5-benzylidene-1-hydroxy-4-oxocyclopent-2-en-1-yl]prop-1-ynyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(C#CCC2(O)C=CC(=O)/C2=C/c2ccccc2)c1 |
| InChI | InChI=1S/C24H21NO3/c1-25(2)23(27)20-12-6-10-18(16-20)11-7-14-24(28)15-13-22(26)21(24)17-19-8-4-3-5-9-19/h3-6,8-10,12-13,15-17,28H,14H2,1-2H3/b21-17- |
| InChIKey | ZMNCUZGZELMGPW-FXBPSFAMSA-N |
| XLogP | 3.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|