C17H18FNO — CID 115958904
2-fluoro-6-(1,2,4,5-tetrahydro-3-benzazepin-3-ylmethyl)phenol (PubChem CID 115958904) has the molecular formula C17H18FNO and a molecular weight of 271.33 g/mol. Its IUPAC name is 2-fluoro-6-(1,2,4,5-tetrahydro-3-benzazepin-3-ylmethyl)phenol.
| Compound Name | 2-fluoro-6-(1,2,4,5-tetrahydro-3-benzazepin-3-ylmethyl)phenol |
|---|---|
| PubChem CID | 115958904 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-fluoro-6-(1,2,4,5-tetrahydro-3-benzazepin-3-ylmethyl)phenol |
| SMILES | Oc1c(F)cccc1CN1CCc2ccccc2CC1 |
| InChI | InChI=1S/C17H18FNO/c18-16-7-3-6-15(17(16)20)12-19-10-8-13-4-1-2-5-14(13)9-11-19/h1-7,20H,8-12H2 |
| InChIKey | BDROMDWWUAKCEE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|