C19H10FN3O6 — CID 11596362
2-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4-nitroisoindole-1,3-dione (PubChem CID 11596362) has the molecular formula C19H10FN3O6 and a molecular weight of 395.30 g/mol. Its IUPAC name is 2-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4-nitroisoindole-1,3-dione.
| Compound Name | 2-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11596362 |
| Molecular Formula | C19H10FN3O6 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-4-nitroisoindole-1,3-dione |
| SMILES | C#CCN1C(=O)COc2cc(F)c(N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)cc21 |
| InChI | InChI=1S/C19H10FN3O6/c1-2-6-21-14-8-13(11(20)7-15(14)29-9-16(21)24)22-18(25)10-4-3-5-12(23(27)28)17(10)19(22)26/h1,3-5,7-8H,6,9H2 |
| InChIKey | NWGGENSEWIFRSY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|