C19H9F2IN2O4 — CID 11496902
4-fluoro-2-[7-fluoro-4-(3-iodoprop-2-ynyl)-3-oxo-1,4-benzoxazin-6-yl]isoindole-1,3-dione (PubChem CID 11496902) has the molecular formula C19H9F2IN2O4 and a molecular weight of 494.19 g/mol. Its IUPAC name is 4-fluoro-2-[7-fluoro-4-(3-iodoprop-2-ynyl)-3-oxo-1,4-benzoxazin-6-yl]isoindole-1,3-dione.
| Compound Name | 4-fluoro-2-[7-fluoro-4-(3-iodoprop-2-ynyl)-3-oxo-1,4-benzoxazin-6-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11496902 |
| Molecular Formula | C19H9F2IN2O4 |
| Molecular Weight | 494.19 g/mol |
| Exact Mass | 493.96 |
| IUPAC Name | 4-fluoro-2-[7-fluoro-4-(3-iodoprop-2-ynyl)-3-oxo-1,4-benzoxazin-6-yl]isoindole-1,3-dione |
| SMILES | O=C1COc2cc(F)c(N3C(=O)c4cccc(F)c4C3=O)cc2N1CC#CI |
| InChI | InChI=1S/C19H9F2IN2O4/c20-11-4-1-3-10-17(11)19(27)24(18(10)26)13-8-14-15(7-12(13)21)28-9-16(25)23(14)6-2-5-22/h1,3-4,7-8H,6,9H2 |
| InChIKey | JXFGVDINLGKISK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.19 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|