C16H10F4N4O4 — CID 19023220
1-amino-3-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-6-(trifluoromethyl)pyrimidine-2,4-dione (PubChem CID 19023220) has the molecular formula C16H10F4N4O4 and a molecular weight of 398.27 g/mol. Its IUPAC name is 1-amino-3-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-6-(trifluoromethyl)pyrimidine-2,4-dione.
| Compound Name | 1-amino-3-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-6-(trifluoromethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19023220 |
| Molecular Formula | C16H10F4N4O4 |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 1-amino-3-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-6-(trifluoromethyl)pyrimidine-2,4-dione |
| SMILES | C#CCN1C(=O)COc2cc(F)c(-n3c(=O)cc(C(F)(F)F)n(N)c3=O)cc21 |
| InChI | InChI=1S/C16H10F4N4O4/c1-2-3-22-10-5-9(8(17)4-11(10)28-7-14(22)26)23-13(25)6-12(16(18,19)20)24(21)15(23)27/h1,4-6H,3,7,21H2 |
| InChIKey | VHVSFHRXNCQKRV-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|