C18H16FN3O4 — CID 19745829
3-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-1,5,6-trimethylpyrimidine-2,4-dione (PubChem CID 19745829) has the molecular formula C18H16FN3O4 and a molecular weight of 357.34 g/mol. Its IUPAC name is 3-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-1,5,6-trimethylpyrimidine-2,4-dione.
| Compound Name | 3-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-1,5,6-trimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 19745829 |
| Molecular Formula | C18H16FN3O4 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 3-(7-fluoro-3-oxo-4-prop-2-ynyl-1,4-benzoxazin-6-yl)-1,5,6-trimethylpyrimidine-2,4-dione |
| SMILES | C#CCN1C(=O)COc2cc(F)c(-n3c(=O)c(C)c(C)n(C)c3=O)cc21 |
| InChI | InChI=1S/C18H16FN3O4/c1-5-6-21-14-8-13(12(19)7-15(14)26-9-16(21)23)22-17(24)10(2)11(3)20(4)18(22)25/h1,7-8H,6,9H2,2-4H3 |
| InChIKey | PHOPNOGESOYWPL-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|