C19H14BFN2O4 — CID 170637282
CID 170637282 (PubChem CID 170637282) has the molecular formula C19H14BFN2O4 and a molecular weight of 364.14 g/mol.
| Compound Name | CID 170637282 |
|---|---|
| PubChem CID | 170637282 |
| Molecular Formula | C19H14BFN2O4 |
| Molecular Weight | 364.14 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | — |
| SMILES | [B]C#CCN1C(=O)COc2cc(F)c(N3C(=O)C4=C(CCCC4)C3=O)cc21 |
| InChI | InChI=1S/C19H14BFN2O4/c20-6-3-7-22-15-9-14(13(21)8-16(15)27-10-17(22)24)23-18(25)11-4-1-2-5-12(11)19(23)26/h8-9H,1-2,4-5,7,10H2 |
| InChIKey | AKRCYAXRNSSATA-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|