C19H13B2FN2O4 — CID 170637278
CID 170637278 (PubChem CID 170637278) has the molecular formula C19H13B2FN2O4 and a molecular weight of 373.95 g/mol.
| Compound Name | CID 170637278 |
|---|---|
| PubChem CID | 170637278 |
| Molecular Formula | C19H13B2FN2O4 |
| Molecular Weight | 373.95 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C#C)N1C(=O)COc2cc(F)c(N3C(=O)C4=C(CCCC4)C3=O)cc21 |
| InChI | InChI=1S/C19H13B2FN2O4/c1-2-19(20,21)24-14-8-13(12(22)7-15(14)28-9-16(24)25)23-17(26)10-5-3-4-6-11(10)18(23)27/h1,7-8H,3-6,9H2 |
| InChIKey | JIQHLEXMBHFGDA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.95 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|