C19H11B2F4N3O4 — CID 170637292
CID 170637292 (PubChem CID 170637292) has the molecular formula C19H11B2F4N3O4 and a molecular weight of 442.93 g/mol.
| Compound Name | CID 170637292 |
|---|---|
| PubChem CID | 170637292 |
| Molecular Formula | C19H11B2F4N3O4 |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | — |
| SMILES | [B]C([B])(C#C)N1C(=O)C2(CC2)Oc2cc(F)c(-n3c(=O)cc(C(F)(F)F)n(C)c3=O)cc21 |
| InChI | InChI=1S/C19H11B2F4N3O4/c1-3-18(20,21)28-11-7-10(9(22)6-12(11)32-17(4-5-17)15(28)30)27-14(29)8-13(19(23,24)25)26(2)16(27)31/h1,6-8H,4-5H2,2H3 |
| InChIKey | DJQKWZTZZBXKMU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 73.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|