C14H23N5O2 — CID 115965181
[3-(1-hydroxyethyl)pyrrolidin-1-yl]-(1-piperidin-4-yltriazol-4-yl)methanone (PubChem CID 115965181) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is [3-(1-hydroxyethyl)pyrrolidin-1-yl]-(1-piperidin-4-yltriazol-4-yl)methanone.
| Compound Name | [3-(1-hydroxyethyl)pyrrolidin-1-yl]-(1-piperidin-4-yltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 115965181 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | [3-(1-hydroxyethyl)pyrrolidin-1-yl]-(1-piperidin-4-yltriazol-4-yl)methanone |
| SMILES | CC(O)C1CCN(C(=O)c2cn(C3CCNCC3)nn2)C1 |
| InChI | InChI=1S/C14H23N5O2/c1-10(20)11-4-7-18(8-11)14(21)13-9-19(17-16-13)12-2-5-15-6-3-12/h9-12,15,20H,2-8H2,1H3 |
| InChIKey | DASCCRIEGRDWAR-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |