C16H27N5O2 — CID 119821796
[3-(2-methylpropoxy)pyrrolidin-1-yl]-(1-piperidin-4-yltriazol-4-yl)methanone (PubChem CID 119821796) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is [3-(2-methylpropoxy)pyrrolidin-1-yl]-(1-piperidin-4-yltriazol-4-yl)methanone.
| Compound Name | [3-(2-methylpropoxy)pyrrolidin-1-yl]-(1-piperidin-4-yltriazol-4-yl)methanone |
|---|---|
| PubChem CID | 119821796 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | [3-(2-methylpropoxy)pyrrolidin-1-yl]-(1-piperidin-4-yltriazol-4-yl)methanone |
| SMILES | CC(C)COC1CCN(C(=O)c2cn(C3CCNCC3)nn2)C1 |
| InChI | InChI=1S/C16H27N5O2/c1-12(2)11-23-14-5-8-20(9-14)16(22)15-10-21(19-18-15)13-3-6-17-7-4-13/h10,12-14,17H,3-9,11H2,1-2H3 |
| InChIKey | IGMYTSGPGOOMNN-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |