C13H22ClN5OS — CID 119774179
(2-methylthiomorpholin-4-yl)-(1-piperidin-4-yltriazol-4-yl)methanone;hydrochloride (PubChem CID 119774179) has the molecular formula C13H22ClN5OS and a molecular weight of 331.87 g/mol. Its IUPAC name is (2-methylthiomorpholin-4-yl)-(1-piperidin-4-yltriazol-4-yl)methanone;hydrochloride.
| Compound Name | (2-methylthiomorpholin-4-yl)-(1-piperidin-4-yltriazol-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119774179 |
| Molecular Formula | C13H22ClN5OS |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (2-methylthiomorpholin-4-yl)-(1-piperidin-4-yltriazol-4-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2cn(C3CCNCC3)nn2)CCS1.Cl |
| InChI | InChI=1S/C13H21N5OS.ClH/c1-10-8-17(6-7-20-10)13(19)12-9-18(16-15-12)11-2-4-14-5-3-11;/h9-11,14H,2-8H2,1H3;1H |
| InChIKey | DXIPADDXIBSGFR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |