C27H25N3O2 — CID 11597008
N-[4-[4-[2-(benzylamino)ethyl]phenoxy]phenyl]pyridine-4-carboxamide (PubChem CID 11597008) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[4-[4-[2-(benzylamino)ethyl]phenoxy]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[4-[4-[2-(benzylamino)ethyl]phenoxy]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 11597008 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[4-[4-[2-(benzylamino)ethyl]phenoxy]phenyl]pyridine-4-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccc(CCNCc3ccccc3)cc2)cc1)c1ccncc1 |
| InChI | InChI=1S/C27H25N3O2/c31-27(23-15-18-28-19-16-23)30-24-8-12-26(13-9-24)32-25-10-6-21(7-11-25)14-17-29-20-22-4-2-1-3-5-22/h1-13,15-16,18-19,29H,14,17,20H2,(H,30,31) |
| InChIKey | VSMHOPUEVDWISA-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|