C26H25N3O4 — CID 66731262
(5-methyl-1,2-oxazol-3-yl) N-[4-[4-[2-(benzylamino)ethyl]phenoxy]phenyl]carbamate (PubChem CID 66731262) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is (5-methyl-1,2-oxazol-3-yl) N-[4-[4-[2-(benzylamino)ethyl]phenoxy]phenyl]carbamate.
| Compound Name | (5-methyl-1,2-oxazol-3-yl) N-[4-[4-[2-(benzylamino)ethyl]phenoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 66731262 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | (5-methyl-1,2-oxazol-3-yl) N-[4-[4-[2-(benzylamino)ethyl]phenoxy]phenyl]carbamate |
| SMILES | Cc1cc(OC(=O)Nc2ccc(Oc3ccc(CCNCc4ccccc4)cc3)cc2)no1 |
| InChI | InChI=1S/C26H25N3O4/c1-19-17-25(29-33-19)32-26(30)28-22-9-13-24(14-10-22)31-23-11-7-20(8-12-23)15-16-27-18-21-5-3-2-4-6-21/h2-14,17,27H,15-16,18H2,1H3,(H,28,30) |
| InChIKey | UKFIZWVWMKWPIJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|