C24H29ClFN3O — CID 11597917
trans-(1R,2R)-N-[3-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]propyl]-2-phenylcyclopropane-1-carboxamide (PubChem CID 11597917) has the molecular formula C24H29ClFN3O and a molecular weight of 429.97 g/mol. Its IUPAC name is trans-(1R,2R)-N-[3-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]propyl]-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[3-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]propyl]-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 11597917 |
| Molecular Formula | C24H29ClFN3O |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | trans-(1R,2R)-N-[3-[4-[(2-chloro-6-fluorophenyl)methyl]piperazin-1-yl]propyl]-2-phenylcyclopropane-1-carboxamide |
| SMILES | O=C(NCCCN1CCN(Cc2c(F)cccc2Cl)CC1)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H29ClFN3O/c25-22-8-4-9-23(26)21(22)17-29-14-12-28(13-15-29)11-5-10-27-24(30)20-16-19(20)18-6-2-1-3-7-18/h1-4,6-9,19-20H,5,10-17H2,(H,27,30)/t19-,20+/m0/s1 |
| InChIKey | GAHQIUCRVXIXRV-VQTJNVASSA-N |
| XLogP | 3.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|