C14H19FN2O4 — CID 115980892
3-[(3-fluoro-5-nitrophenyl)methylamino]-2,2,3-trimethylbutanoic acid (PubChem CID 115980892) has the molecular formula C14H19FN2O4 and a molecular weight of 298.31 g/mol. Its IUPAC name is 3-[(3-fluoro-5-nitrophenyl)methylamino]-2,2,3-trimethylbutanoic acid.
| Compound Name | 3-[(3-fluoro-5-nitrophenyl)methylamino]-2,2,3-trimethylbutanoic acid |
|---|---|
| PubChem CID | 115980892 |
| Molecular Formula | C14H19FN2O4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-[(3-fluoro-5-nitrophenyl)methylamino]-2,2,3-trimethylbutanoic acid |
| SMILES | CC(C)(NCc1cc(F)cc([N+](=O)[O-])c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H19FN2O4/c1-13(2,12(18)19)14(3,4)16-8-9-5-10(15)7-11(6-9)17(20)21/h5-7,16H,8H2,1-4H3,(H,18,19) |
| InChIKey | HZHVHWMQLOQYFS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|