C27H29N5O4 — CID 11598297
(2R)-N-(3-hydroxypropyl)-2-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-5-yl]oxypropanamide (PubChem CID 11598297) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is (2R)-N-(3-hydroxypropyl)-2-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-5-yl]oxypropanamide.
| Compound Name | (2R)-N-(3-hydroxypropyl)-2-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-5-yl]oxypropanamide |
|---|---|
| PubChem CID | 11598297 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | (2R)-N-(3-hydroxypropyl)-2-[4-[3-methyl-4-[(6-methyl-3-pyridinyl)oxy]anilino]quinazolin-5-yl]oxypropanamide |
| SMILES | Cc1ccc(Oc2ccc(Nc3ncnc4cccc(O[C@H](C)C(=O)NCCCO)c34)cc2C)cn1 |
| InChI | InChI=1S/C27H29N5O4/c1-17-14-20(9-11-23(17)36-21-10-8-18(2)29-15-21)32-26-25-22(30-16-31-26)6-4-7-24(25)35-19(3)27(34)28-12-5-13-33/h4,6-11,14-16,19,33H,5,12-13H2,1-3H3,(H,28,34)(H,30,31,32)/t19-/m1/s1 |
| InChIKey | UHNGQLQIXXAYRV-LJQANCHMSA-N |
| XLogP | 4.44 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|