C17H21N3S — CID 115998354
4-[2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,3-thiazol-4-yl]aniline (PubChem CID 115998354) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 4-[2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,3-thiazol-4-yl]aniline.
| Compound Name | 4-[2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 115998354 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-[2-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-1,3-thiazol-4-yl]aniline |
| SMILES | CN1C2CCC1CC(c1nc(-c3ccc(N)cc3)cs1)C2 |
| InChI | InChI=1S/C17H21N3S/c1-20-14-6-7-15(20)9-12(8-14)17-19-16(10-21-17)11-2-4-13(18)5-3-11/h2-5,10,12,14-15H,6-9,18H2,1H3 |
| InChIKey | LXWKQIHPDRWESB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|