C14H14ClNO2S2 — CID 166305504
2-(3-chlorocyclobutyl)-4-(4-methylsulfonylphenyl)-1,3-thiazole (PubChem CID 166305504) has the molecular formula C14H14ClNO2S2 and a molecular weight of 327.86 g/mol. Its IUPAC name is 2-(3-chlorocyclobutyl)-4-(4-methylsulfonylphenyl)-1,3-thiazole.
| Compound Name | 2-(3-chlorocyclobutyl)-4-(4-methylsulfonylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 166305504 |
| Molecular Formula | C14H14ClNO2S2 |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-(3-chlorocyclobutyl)-4-(4-methylsulfonylphenyl)-1,3-thiazole |
| SMILES | CS(=O)(=O)c1ccc(-c2csc(C3CC(Cl)C3)n2)cc1 |
| InChI | InChI=1S/C14H14ClNO2S2/c1-20(17,18)12-4-2-9(3-5-12)13-8-19-14(16-13)10-6-11(15)7-10/h2-5,8,10-11H,6-7H2,1H3 |
| InChIKey | ACSHGTKJPWUJOS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|