C47H50N4O7S4 — CID 174659580
2,4-bis[(2R)-2-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one (PubChem CID 174659580) has the molecular formula C47H50N4O7S4 and a molecular weight of 911.21 g/mol. Its IUPAC name is 2,4-bis[(2R)-2-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one.
| Compound Name | 2,4-bis[(2R)-2-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one |
|---|---|
| PubChem CID | 174659580 |
| Molecular Formula | C47H50N4O7S4 |
| Molecular Weight | 911.21 g/mol |
| Exact Mass | 910.26 |
| IUPAC Name | 2,4-bis[(2R)-2-[4-(4-methylsulfonylphenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one |
| SMILES | CS(=O)(=O)c1ccc(-c2csc([C@H]3CCCCN3C(COc3ccccc3)C(=O)C(COc3ccccc3)N3CCCC[C@@H]3c3nc(-c4ccc(S(C)(=O)=O)cc4)cs3)n2)cc1 |
| InChI | InChI=1S/C47H50N4O7S4/c1-61(53,54)37-23-19-33(20-24-37)39-31-59-46(48-39)41-17-9-11-27-50(41)43(29-57-35-13-5-3-6-14-35)45(52)44(30-58-36-15-7-4-8-16-36)51-28-12-10-18-42(51)47-49-40(32-60-47)34-21-25-38(26-22-34)62(2,55)56/h3-8,13-16,19-26,31-32,41-44H,9-12,17-18,27-30H2,1-2H3/t41-,42-,43?,44?/m1/s1 |
| InChIKey | DFWQBTDONNDLMG-WWYIKPKFSA-N |
| XLogP | 8.96 |
| TPSA | 136.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.21 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |