C22H22ClN3O2S — CID 174659584
2-[2-[4-(6-chloro-3-pyridinyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-phenoxypropanal (PubChem CID 174659584) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is 2-[2-[4-(6-chloro-3-pyridinyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-phenoxypropanal.
| Compound Name | 2-[2-[4-(6-chloro-3-pyridinyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-phenoxypropanal |
|---|---|
| PubChem CID | 174659584 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[2-[4-(6-chloro-3-pyridinyl)-1,3-thiazol-2-yl]piperidin-1-yl]-3-phenoxypropanal |
| SMILES | O=CC(COc1ccccc1)N1CCCCC1c1nc(-c2ccc(Cl)nc2)cs1 |
| InChI | InChI=1S/C22H22ClN3O2S/c23-21-10-9-16(12-24-21)19-15-29-22(25-19)20-8-4-5-11-26(20)17(13-27)14-28-18-6-2-1-3-7-18/h1-3,6-7,9-10,12-13,15,17,20H,4-5,8,11,14H2 |
| InChIKey | CKGBOWXPEDUTQO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|