C45H46N4O5S2 — CID 174659585
2,4-bis[(2R)-2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one (PubChem CID 174659585) has the molecular formula C45H46N4O5S2 and a molecular weight of 787.02 g/mol. Its IUPAC name is 2,4-bis[(2R)-2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one.
| Compound Name | 2,4-bis[(2R)-2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one |
|---|---|
| PubChem CID | 174659585 |
| Molecular Formula | C45H46N4O5S2 |
| Molecular Weight | 787.02 g/mol |
| Exact Mass | 786.29 |
| IUPAC Name | 2,4-bis[(2R)-2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]piperidin-1-yl]-1,5-diphenoxypentan-3-one |
| SMILES | O=C(C(COc1ccccc1)N1CCCC[C@@H]1c1nc(-c2ccc(O)cc2)cs1)C(COc1ccccc1)N1CCCC[C@@H]1c1nc(-c2ccc(O)cc2)cs1 |
| InChI | InChI=1S/C45H46N4O5S2/c50-33-21-17-31(18-22-33)37-29-55-44(46-37)39-15-7-9-25-48(39)41(27-53-35-11-3-1-4-12-35)43(52)42(28-54-36-13-5-2-6-14-36)49-26-10-8-16-40(49)45-47-38(30-56-45)32-19-23-34(51)24-20-32/h1-6,11-14,17-24,29-30,39-42,50-51H,7-10,15-16,25-28H2/t39-,40-,41?,42?/m1/s1 |
| InChIKey | JYNMMGIZXTVDOI-PPSFMLEKSA-N |
| XLogP | 9.56 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.02 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |