C12H13N3S — CID 116965519
3-(4-pyridin-4-yl-1,3-thiazol-2-yl)cyclobutan-1-amine (PubChem CID 116965519) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 3-(4-pyridin-4-yl-1,3-thiazol-2-yl)cyclobutan-1-amine.
| Compound Name | 3-(4-pyridin-4-yl-1,3-thiazol-2-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 116965519 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-(4-pyridin-4-yl-1,3-thiazol-2-yl)cyclobutan-1-amine |
| SMILES | NC1CC(c2nc(-c3ccncc3)cs2)C1 |
| InChI | InChI=1S/C12H13N3S/c13-10-5-9(6-10)12-15-11(7-16-12)8-1-3-14-4-2-8/h1-4,7,9-10H,5-6,13H2 |
| InChIKey | RTJNDPGJNXNVBP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |