C11H12N2S2 — CID 116965488
3-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclobutan-1-amine (PubChem CID 116965488) has the molecular formula C11H12N2S2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclobutan-1-amine.
| Compound Name | 3-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 116965488 |
| Molecular Formula | C11H12N2S2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(4-thiophen-2-yl-1,3-thiazol-2-yl)cyclobutan-1-amine |
| SMILES | NC1CC(c2nc(-c3cccs3)cs2)C1 |
| InChI | InChI=1S/C11H12N2S2/c12-8-4-7(5-8)11-13-9(6-15-11)10-2-1-3-14-10/h1-3,6-8H,4-5,12H2 |
| InChIKey | FQPMJIJXWQJSGU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |