C13H13FN2S — CID 116965515
3-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]cyclobutan-1-amine (PubChem CID 116965515) has the molecular formula C13H13FN2S and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]cyclobutan-1-amine.
| Compound Name | 3-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 116965515 |
| Molecular Formula | C13H13FN2S |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-[4-(3-fluorophenyl)-1,3-thiazol-2-yl]cyclobutan-1-amine |
| SMILES | NC1CC(c2nc(-c3cccc(F)c3)cs2)C1 |
| InChI | InChI=1S/C13H13FN2S/c14-10-3-1-2-8(4-10)12-7-17-13(16-12)9-5-11(15)6-9/h1-4,7,9,11H,5-6,15H2 |
| InChIKey | YIPYRRUFPISVSK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |