C22H40O6 — CID 11603723
tert-butyl (6E,8S,9S,10R,11E)-13-hydroxy-8-methoxy-9-(methoxymethoxy)-10,12-dimethyltrideca-6,11-dienoate (PubChem CID 11603723) has the molecular formula C22H40O6 and a molecular weight of 400.56 g/mol. Its IUPAC name is tert-butyl (6E,8S,9S,10R,11E)-13-hydroxy-8-methoxy-9-(methoxymethoxy)-10,12-dimethyltrideca-6,11-dienoate.
| Compound Name | tert-butyl (6E,8S,9S,10R,11E)-13-hydroxy-8-methoxy-9-(methoxymethoxy)-10,12-dimethyltrideca-6,11-dienoate |
|---|---|
| PubChem CID | 11603723 |
| Molecular Formula | C22H40O6 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | tert-butyl (6E,8S,9S,10R,11E)-13-hydroxy-8-methoxy-9-(methoxymethoxy)-10,12-dimethyltrideca-6,11-dienoate |
| SMILES | COCO[C@@H]([C@H](C)/C=C(\C)CO)[C@H](/C=C/CCCCC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C22H40O6/c1-17(15-23)14-18(2)21(27-16-25-6)19(26-7)12-10-8-9-11-13-20(24)28-22(3,4)5/h10,12,14,18-19,21,23H,8-9,11,13,15-16H2,1-7H3/b12-10+,17-14+/t18-,19+,21+/m1/s1 |
| InChIKey | PWNKMWVXBXYADL-QCCAXJIRSA-N |
| XLogP | 4.02 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|