C26H27N2O9P — CID 11606329
[4-[(2S)-2-amino-3-[2-methoxy-5-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]anilino]-3-oxopropyl]phenyl] dihydrogen phosphate (PubChem CID 11606329) has the molecular formula C26H27N2O9P and a molecular weight of 542.48 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-[2-methoxy-5-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]anilino]-3-oxopropyl]phenyl] dihydrogen phosphate.
| Compound Name | [4-[(2S)-2-amino-3-[2-methoxy-5-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]anilino]-3-oxopropyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 11606329 |
| Molecular Formula | C26H27N2O9P |
| Molecular Weight | 542.48 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | [4-[(2S)-2-amino-3-[2-methoxy-5-[(Z)-2-(7-methoxy-1,3-benzodioxol-5-yl)ethenyl]anilino]-3-oxopropyl]phenyl] dihydrogen phosphate |
| SMILES | COc1ccc(/C=C\c2cc(OC)c3c(c2)OCO3)cc1NC(=O)[C@@H](N)Cc1ccc(OP(=O)(O)O)cc1 |
| InChI | InChI=1S/C26H27N2O9P/c1-33-22-10-7-17(3-4-18-13-23(34-2)25-24(14-18)35-15-36-25)12-21(22)28-26(29)20(27)11-16-5-8-19(9-6-16)37-38(30,31)32/h3-10,12-14,20H,11,15,27H2,1-2H3,(H,28,29)(H2,30,31,32)/b4-3-/t20-/m0/s1 |
| InChIKey | WXEHVGISBLCNOD-XQQSMPNESA-N |
| XLogP | 3.58 |
| TPSA | 158.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|