C12H18N2O5 — CID 11608726
methyl (2S)-2-[[2-[hydroxy(methyl)amino]-3,4-dioxocyclobuten-1-yl]amino]-4-methylpentanoate (PubChem CID 11608726) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[hydroxy(methyl)amino]-3,4-dioxocyclobuten-1-yl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[2-[hydroxy(methyl)amino]-3,4-dioxocyclobuten-1-yl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 11608726 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | methyl (2S)-2-[[2-[hydroxy(methyl)amino]-3,4-dioxocyclobuten-1-yl]amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)Nc1c(N(C)O)c(=O)c1=O |
| InChI | InChI=1S/C12H18N2O5/c1-6(2)5-7(12(17)19-4)13-8-9(14(3)18)11(16)10(8)15/h6-7,13,18H,5H2,1-4H3/t7-/m0/s1 |
| InChIKey | IMLBDMXAWRMCOL-ZETCQYMHSA-N |
| XLogP | 0.11 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|