C30H21Br3 — CID 11614249
1,3,5-tris[4-[(Z)-2-bromoethenyl]phenyl]benzene (PubChem CID 11614249) has the molecular formula C30H21Br3 and a molecular weight of 621.21 g/mol. Its IUPAC name is 1,3,5-tris[4-[(Z)-2-bromoethenyl]phenyl]benzene.
| Compound Name | 1,3,5-tris[4-[(Z)-2-bromoethenyl]phenyl]benzene |
|---|---|
| PubChem CID | 11614249 |
| Molecular Formula | C30H21Br3 |
| Molecular Weight | 621.21 g/mol |
| Exact Mass | 617.92 |
| IUPAC Name | 1,3,5-tris[4-[(Z)-2-bromoethenyl]phenyl]benzene |
| SMILES | Br/C=C\c1ccc(-c2cc(-c3ccc(/C=C\Br)cc3)cc(-c3ccc(/C=C\Br)cc3)c2)cc1 |
| InChI | InChI=1S/C30H21Br3/c31-16-13-22-1-7-25(8-2-22)28-19-29(26-9-3-23(4-10-26)14-17-32)21-30(20-28)27-11-5-24(6-12-27)15-18-33/h1-21H/b16-13-,17-14-,18-15- |
| InChIKey | YQRLMSFISSZFGM-WLFVLELZSA-N |
| XLogP | 10.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.21 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |