C14H21FO4 — CID 11616023
ethyl 2-fluoro-2-[(2S,3R)-2-(2-oxocyclohexyl)oxolan-3-yl]acetate (PubChem CID 11616023) has the molecular formula C14H21FO4 and a molecular weight of 272.32 g/mol. Its IUPAC name is ethyl 2-fluoro-2-[(2S,3R)-2-(2-oxocyclohexyl)oxolan-3-yl]acetate.
| Compound Name | ethyl 2-fluoro-2-[(2S,3R)-2-(2-oxocyclohexyl)oxolan-3-yl]acetate |
|---|---|
| PubChem CID | 11616023 |
| Molecular Formula | C14H21FO4 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | ethyl 2-fluoro-2-[(2S,3R)-2-(2-oxocyclohexyl)oxolan-3-yl]acetate |
| SMILES | CCOC(=O)C(F)[C@@H]1CCO[C@H]1C1CCCCC1=O |
| InChI | InChI=1S/C14H21FO4/c1-2-18-14(17)12(15)10-7-8-19-13(10)9-5-3-4-6-11(9)16/h9-10,12-13H,2-8H2,1H3/t9?,10-,12?,13-/m0/s1 |
| InChIKey | MRYMIHPLPBSWNL-MZYPSXCRSA-N |
| XLogP | 2.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |